C18H21NO4S — CID 95281291
(2S,3S)-2-(1-benzothiophen-3-yl)-1-(3-methoxypropyl)-6-oxopiperidine-3-carboxylic acid (PubChem CID 95281291) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is (2S,3S)-2-(1-benzothiophen-3-yl)-1-(3-methoxypropyl)-6-oxopiperidine-3-carboxylic acid.
| Compound Name | (2S,3S)-2-(1-benzothiophen-3-yl)-1-(3-methoxypropyl)-6-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95281291 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (2S,3S)-2-(1-benzothiophen-3-yl)-1-(3-methoxypropyl)-6-oxopiperidine-3-carboxylic acid |
| SMILES | COCCCN1C(=O)CC[C@H](C(=O)O)[C@H]1c1csc2ccccc12 |
| InChI | InChI=1S/C18H21NO4S/c1-23-10-4-9-19-16(20)8-7-13(18(21)22)17(19)14-11-24-15-6-3-2-5-12(14)15/h2-3,5-6,11,13,17H,4,7-10H2,1H3,(H,21,22)/t13-,17-/m0/s1 |
| InChIKey | KFCJSYCQUHIIAG-GUYCJALGSA-N |
| XLogP | 3.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|