C13H16F3N3O2S — CID 95281991
(3S)-N-(cyanomethyl)-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-N-propylbutanamide (PubChem CID 95281991) has the molecular formula C13H16F3N3O2S and a molecular weight of 335.35 g/mol. Its IUPAC name is (3S)-N-(cyanomethyl)-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-N-propylbutanamide.
| Compound Name | (3S)-N-(cyanomethyl)-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-N-propylbutanamide |
|---|---|
| PubChem CID | 95281991 |
| Molecular Formula | C13H16F3N3O2S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (3S)-N-(cyanomethyl)-4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-N-propylbutanamide |
| SMILES | CCCN(CC#N)C(=O)C[C@@](O)(c1nc(C)cs1)C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O2S/c1-3-5-19(6-4-17)10(20)7-12(21,13(14,15)16)11-18-9(2)8-22-11/h8,21H,3,5-7H2,1-2H3/t12-/m1/s1 |
| InChIKey | LMVAHDPTNJBTDW-GFCCVEGCSA-N |
| XLogP | 2.35 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|