C17H20N2O3 — CID 95286558
(3R)-6-oxo-N-[2-(4-prop-2-ynoxyphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 95286558) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3R)-6-oxo-N-[2-(4-prop-2-ynoxyphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | (3R)-6-oxo-N-[2-(4-prop-2-ynoxyphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95286558 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3R)-6-oxo-N-[2-(4-prop-2-ynoxyphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | C#CCOc1ccc(CCNC(=O)[C@@H]2CCC(=O)NC2)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-2-11-22-15-6-3-13(4-7-15)9-10-18-17(21)14-5-8-16(20)19-12-14/h1,3-4,6-7,14H,5,8-12H2,(H,18,21)(H,19,20)/t14-/m1/s1 |
| InChIKey | SJGUKHPJEGRJAI-CQSZACIVSA-N |
| XLogP | 0.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|