C29H32N2O4 — CID 160937779
N-[2-[4-methyl-2,3-bis(phenylmethoxy)phenyl]ethyl]-6-oxopiperidine-3-carboxamide (PubChem CID 160937779) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[2-[4-methyl-2,3-bis(phenylmethoxy)phenyl]ethyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[2-[4-methyl-2,3-bis(phenylmethoxy)phenyl]ethyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 160937779 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | N-[2-[4-methyl-2,3-bis(phenylmethoxy)phenyl]ethyl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1ccc(CCNC(=O)C2CCC(=O)NC2)c(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H32N2O4/c1-21-12-13-24(16-17-30-29(33)25-14-15-26(32)31-18-25)28(35-20-23-10-6-3-7-11-23)27(21)34-19-22-8-4-2-5-9-22/h2-13,25H,14-20H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | VYMARLBMLJWENK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |