C18H27N3O2S — CID 95286627
(3R)-3-hydroxy-N-[4-(2-thiomorpholin-4-ylethyl)phenyl]piperidine-1-carboxamide (PubChem CID 95286627) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (3R)-3-hydroxy-N-[4-(2-thiomorpholin-4-ylethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-hydroxy-N-[4-(2-thiomorpholin-4-ylethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95286627 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3R)-3-hydroxy-N-[4-(2-thiomorpholin-4-ylethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(CCN2CCSCC2)cc1)N1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C18H27N3O2S/c22-17-2-1-8-21(14-17)18(23)19-16-5-3-15(4-6-16)7-9-20-10-12-24-13-11-20/h3-6,17,22H,1-2,7-14H2,(H,19,23)/t17-/m1/s1 |
| InChIKey | OMBPYGKPYRYZHQ-QGZVFWFLSA-N |
| XLogP | 2.27 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |