C22H37N5OS — CID 86796852
1-[4-(4-methylpiperazin-1-yl)butan-2-yl]-3-[4-(2-thiomorpholin-4-ylethyl)phenyl]urea (PubChem CID 86796852) has the molecular formula C22H37N5OS and a molecular weight of 419.64 g/mol. Its IUPAC name is 1-[4-(4-methylpiperazin-1-yl)butan-2-yl]-3-[4-(2-thiomorpholin-4-ylethyl)phenyl]urea.
| Compound Name | 1-[4-(4-methylpiperazin-1-yl)butan-2-yl]-3-[4-(2-thiomorpholin-4-ylethyl)phenyl]urea |
|---|---|
| PubChem CID | 86796852 |
| Molecular Formula | C22H37N5OS |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 1-[4-(4-methylpiperazin-1-yl)butan-2-yl]-3-[4-(2-thiomorpholin-4-ylethyl)phenyl]urea |
| SMILES | CC(CCN1CCN(C)CC1)NC(=O)Nc1ccc(CCN2CCSCC2)cc1 |
| InChI | InChI=1S/C22H37N5OS/c1-19(7-9-26-13-11-25(2)12-14-26)23-22(28)24-21-5-3-20(4-6-21)8-10-27-15-17-29-18-16-27/h3-6,19H,7-18H2,1-2H3,(H2,23,24,28) |
| InChIKey | ZAOXGROPQOBMIB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |