C21H26ClN3OS — CID 60606653
1-[1-(4-chlorophenyl)ethyl]-3-[4-(2-thiomorpholin-4-ylethyl)phenyl]urea (PubChem CID 60606653) has the molecular formula C21H26ClN3OS and a molecular weight of 403.98 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethyl]-3-[4-(2-thiomorpholin-4-ylethyl)phenyl]urea.
| Compound Name | 1-[1-(4-chlorophenyl)ethyl]-3-[4-(2-thiomorpholin-4-ylethyl)phenyl]urea |
|---|---|
| PubChem CID | 60606653 |
| Molecular Formula | C21H26ClN3OS |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethyl]-3-[4-(2-thiomorpholin-4-ylethyl)phenyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(CCN2CCSCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H26ClN3OS/c1-16(18-4-6-19(22)7-5-18)23-21(26)24-20-8-2-17(3-9-20)10-11-25-12-14-27-15-13-25/h2-9,16H,10-15H2,1H3,(H2,23,24,26) |
| InChIKey | HOXKSKDFIQWZQQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |