C16H17F4N3O — CID 95287399
1-ethyl-N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 95287399) has the molecular formula C16H17F4N3O and a molecular weight of 343.32 g/mol. Its IUPAC name is 1-ethyl-N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 95287399 |
| Molecular Formula | C16H17F4N3O |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-ethyl-N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCn1ncc(C(=O)N[C@@H](C)Cc2ccccc2F)c1C(F)(F)F |
| InChI | InChI=1S/C16H17F4N3O/c1-3-23-14(16(18,19)20)12(9-21-23)15(24)22-10(2)8-11-6-4-5-7-13(11)17/h4-7,9-10H,3,8H2,1-2H3,(H,22,24)/t10-/m0/s1 |
| InChIKey | HERFCCLSYVINNJ-JTQLQIEISA-N |
| XLogP | 3.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |