C14H16F3N3O3 — CID 111482668
1-ethyl-N-[2-(furan-2-yl)-2-hydroxypropyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 111482668) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 1-ethyl-N-[2-(furan-2-yl)-2-hydroxypropyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-[2-(furan-2-yl)-2-hydroxypropyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 111482668 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-ethyl-N-[2-(furan-2-yl)-2-hydroxypropyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCn1ncc(C(=O)NCC(C)(O)c2ccco2)c1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O3/c1-3-20-11(14(15,16)17)9(7-19-20)12(21)18-8-13(2,22)10-5-4-6-23-10/h4-7,22H,3,8H2,1-2H3,(H,18,21) |
| InChIKey | WBWNRPHVJUWZAE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |