C15H26N2O3S — CID 95287702
(2S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-2-(2-ethoxyethoxy)propanamide (PubChem CID 95287702) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is (2S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-2-(2-ethoxyethoxy)propanamide.
| Compound Name | (2S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-2-(2-ethoxyethoxy)propanamide |
|---|---|
| PubChem CID | 95287702 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-2-(2-ethoxyethoxy)propanamide |
| SMILES | CCOCCO[C@@H](C)C(=O)NCc1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H26N2O3S/c1-6-19-7-8-20-11(2)13(18)16-9-12-10-21-14(17-12)15(3,4)5/h10-11H,6-9H2,1-5H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | CQHDETVKHOCQKN-NSHDSACASA-N |
| XLogP | 2.50 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|