C18H19FN2O2 — CID 95288243
2-[(1S)-cyclopent-2-en-1-yl]-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]acetamide (PubChem CID 95288243) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 95288243 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]acetamide |
| SMILES | O=C(C[C@H]1C=CCC1)NCCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H19FN2O2/c19-15-7-5-14(6-8-15)18-21-16(12-23-18)9-10-20-17(22)11-13-3-1-2-4-13/h1,3,5-8,12-13H,2,4,9-11H2,(H,20,22)/t13-/m0/s1 |
| InChIKey | NMVLQDQOMAFHOJ-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|