C13H15N7O2 — CID 95288438
1,3-dimethyl-2,4-dioxo-6-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]pyrimidine-5-carbonitrile (PubChem CID 95288438) has the molecular formula C13H15N7O2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-6-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 1,3-dimethyl-2,4-dioxo-6-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 95288438 |
| Molecular Formula | C13H15N7O2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-6-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]pyrimidine-5-carbonitrile |
| SMILES | Cn1c(N[C@H]2CCc3ncnn3C2)c(C#N)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H15N7O2/c1-18-11(9(5-14)12(21)19(2)13(18)22)17-8-3-4-10-15-7-16-20(10)6-8/h7-8,17H,3-4,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | CCXLNJPOLPUAAD-QMMMGPOBSA-N |
| XLogP | -1.03 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |