C18H21N3O2 — CID 95290424
(3R,6S)-6-methyl-1-(2-methylquinoline-4-carbonyl)piperidine-3-carboxamide (PubChem CID 95290424) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3R,6S)-6-methyl-1-(2-methylquinoline-4-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R,6S)-6-methyl-1-(2-methylquinoline-4-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95290424 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3R,6S)-6-methyl-1-(2-methylquinoline-4-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N2C[C@H](C(N)=O)CC[C@@H]2C)c2ccccc2n1 |
| InChI | InChI=1S/C18H21N3O2/c1-11-9-15(14-5-3-4-6-16(14)20-11)18(23)21-10-13(17(19)22)8-7-12(21)2/h3-6,9,12-13H,7-8,10H2,1-2H3,(H2,19,22)/t12-,13+/m0/s1 |
| InChIKey | QVJOMEOMWFPJTH-QWHCGFSZSA-N |
| XLogP | 2.27 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |