C17H19N3O5 — CID 95294364
N-cyclopropyl-N-[(1R)-1-(furan-2-yl)ethyl]-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide (PubChem CID 95294364) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-cyclopropyl-N-[(1R)-1-(furan-2-yl)ethyl]-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide.
| Compound Name | N-cyclopropyl-N-[(1R)-1-(furan-2-yl)ethyl]-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 95294364 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-cyclopropyl-N-[(1R)-1-(furan-2-yl)ethyl]-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)N(C2CC2)[C@H](C)c2ccco2)C1=O |
| InChI | InChI=1S/C17H19N3O5/c1-3-8-18-15(22)16(23)19(17(18)24)10-14(21)20(12-6-7-12)11(2)13-5-4-9-25-13/h3-5,9,11-12H,1,6-8,10H2,2H3/t11-/m1/s1 |
| InChIKey | ZUYWBVBGEJOLPW-LLVKDONJSA-N |
| XLogP | 1.31 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|