C18H25ClN2O2 — CID 95294622
N-[4-[[(1R,2S)-2-(2-chlorophenyl)cyclopropyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 95294622) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is N-[4-[[(1R,2S)-2-(2-chlorophenyl)cyclopropyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[[(1R,2S)-2-(2-chlorophenyl)cyclopropyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 95294622 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[4-[[(1R,2S)-2-(2-chlorophenyl)cyclopropyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCC(=O)N[C@@H]1C[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C18H25ClN2O2/c1-18(2,3)17(23)20-10-6-9-16(22)21-15-11-13(15)12-7-4-5-8-14(12)19/h4-5,7-8,13,15H,6,9-11H2,1-3H3,(H,20,23)(H,21,22)/t13-,15+/m0/s1 |
| InChIKey | AIJZSQVEWINWIG-DZGCQCFKSA-N |
| XLogP | 3.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|