C19H22N4O2 — CID 95294822
2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(1H-indazole-3-carbonyl)piperazin-1-yl]ethanone (PubChem CID 95294822) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(1H-indazole-3-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(1H-indazole-3-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 95294822 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(1H-indazole-3-carbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(C[C@H]1C=CCC1)N1CCN(C(=O)c2n[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H22N4O2/c24-17(13-14-5-1-2-6-14)22-9-11-23(12-10-22)19(25)18-15-7-3-4-8-16(15)20-21-18/h1,3-5,7-8,14H,2,6,9-13H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | NGOMKRGJBOUVAP-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|