C16H30N2O4 — CID 95295293
(2S)-2-(2-ethoxyethoxy)-N-[3-[(2R)-2-methylpiperidin-1-yl]-3-oxopropyl]propanamide (PubChem CID 95295293) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S)-2-(2-ethoxyethoxy)-N-[3-[(2R)-2-methylpiperidin-1-yl]-3-oxopropyl]propanamide.
| Compound Name | (2S)-2-(2-ethoxyethoxy)-N-[3-[(2R)-2-methylpiperidin-1-yl]-3-oxopropyl]propanamide |
|---|---|
| PubChem CID | 95295293 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (2S)-2-(2-ethoxyethoxy)-N-[3-[(2R)-2-methylpiperidin-1-yl]-3-oxopropyl]propanamide |
| SMILES | CCOCCO[C@@H](C)C(=O)NCCC(=O)N1CCCC[C@H]1C |
| InChI | InChI=1S/C16H30N2O4/c1-4-21-11-12-22-14(3)16(20)17-9-8-15(19)18-10-6-5-7-13(18)2/h13-14H,4-12H2,1-3H3,(H,17,20)/t13-,14+/m1/s1 |
| InChIKey | JACORYVGLWJOGL-KGLIPLIRSA-N |
| XLogP | 1.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|