C13H23NO5 — CID 120675280
cis-(1S,3R)-3-[2-(2-ethoxyethoxy)propanoylamino]cyclopentane-1-carboxylic acid (PubChem CID 120675280) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is cis-(1S,3R)-3-[2-(2-ethoxyethoxy)propanoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[2-(2-ethoxyethoxy)propanoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120675280 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | cis-(1S,3R)-3-[2-(2-ethoxyethoxy)propanoylamino]cyclopentane-1-carboxylic acid |
| SMILES | CCOCCOC(C)C(=O)N[C@@H]1CC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H23NO5/c1-3-18-6-7-19-9(2)12(15)14-11-5-4-10(8-11)13(16)17/h9-11H,3-8H2,1-2H3,(H,14,15)(H,16,17)/t9?,10-,11+/m0/s1 |
| InChIKey | YAFCZASVGBSUGF-QXXIUIOUSA-N |
| XLogP | 0.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|