C19H25N3O3 — CID 95304351
1-[3-(2,5-dioxopyrrolidin-1-yl)-4-methylphenyl]-3-[(1S,2R)-2-methylcyclohexyl]urea (PubChem CID 95304351) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrolidin-1-yl)-4-methylphenyl]-3-[(1S,2R)-2-methylcyclohexyl]urea.
| Compound Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)-4-methylphenyl]-3-[(1S,2R)-2-methylcyclohexyl]urea |
|---|---|
| PubChem CID | 95304351 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)-4-methylphenyl]-3-[(1S,2R)-2-methylcyclohexyl]urea |
| SMILES | Cc1ccc(NC(=O)N[C@H]2CCCC[C@H]2C)cc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C19H25N3O3/c1-12-5-3-4-6-15(12)21-19(25)20-14-8-7-13(2)16(11-14)22-17(23)9-10-18(22)24/h7-8,11-12,15H,3-6,9-10H2,1-2H3,(H2,20,21,25)/t12-,15+/m1/s1 |
| InChIKey | JEOHPWZIDMDYTJ-DOMZBBRYSA-N |
| XLogP | 3.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|