C17H19FN4O3 — CID 95307033
N-[(R)-cyclobutyl-(4-fluorophenyl)methyl]-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 95307033) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is N-[(R)-cyclobutyl-(4-fluorophenyl)methyl]-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(R)-cyclobutyl-(4-fluorophenyl)methyl]-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 95307033 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[(R)-cyclobutyl-(4-fluorophenyl)methyl]-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)N[C@@H](c1ccc(F)cc1)C1CCC1 |
| InChI | InChI=1S/C17H19FN4O3/c18-14-6-4-13(5-7-14)17(12-2-1-3-12)20-16(23)8-9-21-11-15(10-19-21)22(24)25/h4-7,10-12,17H,1-3,8-9H2,(H,20,23)/t17-/m1/s1 |
| InChIKey | GZZIGXQZHACBFM-QGZVFWFLSA-N |
| XLogP | 2.98 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|