C13H20N4O3S — CID 95770990
N-[(1R,3R)-3-methylsulfanylcyclohexyl]-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 95770990) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is N-[(1R,3R)-3-methylsulfanylcyclohexyl]-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(1R,3R)-3-methylsulfanylcyclohexyl]-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 95770990 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[(1R,3R)-3-methylsulfanylcyclohexyl]-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | CS[C@@H]1CCC[C@@H](NC(=O)CCn2cc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C13H20N4O3S/c1-21-12-4-2-3-10(7-12)15-13(18)5-6-16-9-11(8-14-16)17(19)20/h8-10,12H,2-7H2,1H3,(H,15,18)/t10-,12-/m1/s1 |
| InChIKey | WELWGCSZYHMEDD-ZYHUDNBSSA-N |
| XLogP | 1.97 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|