C21H33N3O — CID 95309072
(4-tert-butylphenyl)-[(3S)-3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]methanone (PubChem CID 95309072) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[(3S)-3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-tert-butylphenyl)-[(3S)-3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95309072 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | (4-tert-butylphenyl)-[(3S)-3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]methanone |
| SMILES | CCN1CCN([C@H]2CCN(C(=O)c3ccc(C(C)(C)C)cc3)C2)CC1 |
| InChI | InChI=1S/C21H33N3O/c1-5-22-12-14-23(15-13-22)19-10-11-24(16-19)20(25)17-6-8-18(9-7-17)21(2,3)4/h6-9,19H,5,10-16H2,1-4H3/t19-/m0/s1 |
| InChIKey | KQSOFVNXPGSASA-IBGZPJMESA-N |
| XLogP | 2.84 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |