C16H16N2O4 — CID 95309295
(1S,6S)-6-[(3-oxo-1,2-dihydroisoindol-5-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 95309295) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is (1S,6S)-6-[(3-oxo-1,2-dihydroisoindol-5-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[(3-oxo-1,2-dihydroisoindol-5-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 95309295 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (1S,6S)-6-[(3-oxo-1,2-dihydroisoindol-5-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C1NCc2ccc(NC(=O)[C@H]3CC=CC[C@@H]3C(=O)O)cc21 |
| InChI | InChI=1S/C16H16N2O4/c19-14-13-7-10(6-5-9(13)8-17-14)18-15(20)11-3-1-2-4-12(11)16(21)22/h1-2,5-7,11-12H,3-4,8H2,(H,17,19)(H,18,20)(H,21,22)/t11-,12-/m0/s1 |
| InChIKey | RCMSONRCGLEUEM-RYUDHWBXSA-N |
| XLogP | 1.54 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|