C14H17ClN2O3S — CID 95312101
3-chloro-N-(2-cyanoethyl)-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide (PubChem CID 95312101) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is 3-chloro-N-(2-cyanoethyl)-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-(2-cyanoethyl)-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95312101 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-chloro-N-(2-cyanoethyl)-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide |
| SMILES | N#CCCN(C[C@H]1CCOC1)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2O3S/c15-13-3-1-4-14(9-13)21(18,19)17(7-2-6-16)10-12-5-8-20-11-12/h1,3-4,9,12H,2,5,7-8,10-11H2/t12-/m1/s1 |
| InChIKey | KNIYNDKHXOUNKC-GFCCVEGCSA-N |
| XLogP | 2.28 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |