C16H17Cl2N3O — CID 95313849
2-(3,4-dichlorophenyl)-1-[(3R)-3-imidazol-1-ylpiperidin-1-yl]ethanone (PubChem CID 95313849) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[(3R)-3-imidazol-1-ylpiperidin-1-yl]ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[(3R)-3-imidazol-1-ylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95313849 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[(3R)-3-imidazol-1-ylpiperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCC[C@@H](n2ccnc2)C1 |
| InChI | InChI=1S/C16H17Cl2N3O/c17-14-4-3-12(8-15(14)18)9-16(22)20-6-1-2-13(10-20)21-7-5-19-11-21/h3-5,7-8,11,13H,1-2,6,9-10H2/t13-/m1/s1 |
| InChIKey | RBZSAFGEWHPXQJ-CYBMUJFWSA-N |
| XLogP | 3.60 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |