C16H18N6O2 — CID 95314021
(6S)-N-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95314021) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is (6S)-N-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95314021 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (6S)-N-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | COc1ccc(-c2nnc(CN[C@H]3CCc4ncnn4C3)o2)cc1 |
| InChI | InChI=1S/C16H18N6O2/c1-23-13-5-2-11(3-6-13)16-21-20-15(24-16)8-17-12-4-7-14-18-10-19-22(14)9-12/h2-3,5-6,10,12,17H,4,7-9H2,1H3/t12-/m0/s1 |
| InChIKey | OOQSRKITEMDLBJ-LBPRGKRZSA-N |
| XLogP | 1.44 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |