C15H20ClN3O3 — CID 95317625
(2S)-2-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]-N-(methylcarbamoyl)propanamide (PubChem CID 95317625) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]-N-(methylcarbamoyl)propanamide.
| Compound Name | (2S)-2-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 95317625 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2S)-2-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)[C@H](C)N1CCO[C@H](c2ccccc2Cl)C1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-10(14(20)18-15(21)17-2)19-7-8-22-13(9-19)11-5-3-4-6-12(11)16/h3-6,10,13H,7-9H2,1-2H3,(H2,17,18,20,21)/t10-,13-/m0/s1 |
| InChIKey | WMYNPKHUYFSZDM-GWCFXTLKSA-N |
| XLogP | 1.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |