C12H23N3O — CID 95318568
1-ethyl-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]-2-prop-2-enylguanidine (PubChem CID 95318568) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-ethyl-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]-2-prop-2-enylguanidine.
| Compound Name | 1-ethyl-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]-2-prop-2-enylguanidine |
|---|---|
| PubChem CID | 95318568 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-ethyl-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]-2-prop-2-enylguanidine |
| SMILES | C=CC/N=C(\NCC)N[C@H](C)[C@H]1CCCO1 |
| InChI | InChI=1S/C12H23N3O/c1-4-8-14-12(13-5-2)15-10(3)11-7-6-9-16-11/h4,10-11H,1,5-9H2,2-3H3,(H2,13,14,15)/t10-,11-/m1/s1 |
| InChIKey | AMZAAGOECVBMQD-GHMZBOCLSA-N |
| XLogP | 1.29 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|