C14H16N4O2S — CID 95319281
5-[(3S)-3-imidazol-1-ylpiperidine-1-carbonyl]thiophene-2-carboxamide (PubChem CID 95319281) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 5-[(3S)-3-imidazol-1-ylpiperidine-1-carbonyl]thiophene-2-carboxamide.
| Compound Name | 5-[(3S)-3-imidazol-1-ylpiperidine-1-carbonyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 95319281 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 5-[(3S)-3-imidazol-1-ylpiperidine-1-carbonyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(C(=O)N2CCC[C@H](n3ccnc3)C2)s1 |
| InChI | InChI=1S/C14H16N4O2S/c15-13(19)11-3-4-12(21-11)14(20)17-6-1-2-10(8-17)18-7-5-16-9-18/h3-5,7,9-10H,1-2,6,8H2,(H2,15,19)/t10-/m0/s1 |
| InChIKey | MTYJQQMMAYCFJK-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |