C16H16F3N3O2 — CID 95340983
[(3S)-3-imidazol-1-ylpiperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 95340983) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is [(3S)-3-imidazol-1-ylpiperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [(3S)-3-imidazol-1-ylpiperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 95340983 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | [(3S)-3-imidazol-1-ylpiperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)N1CCC[C@H](n2ccnc2)C1 |
| InChI | InChI=1S/C16H16F3N3O2/c17-16(18,19)24-14-5-3-12(4-6-14)15(23)21-8-1-2-13(10-21)22-9-7-20-11-22/h3-7,9,11,13H,1-2,8,10H2/t13-/m0/s1 |
| InChIKey | INWIVHCNIPOORM-ZDUSSCGKSA-N |
| XLogP | 3.26 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |