C15H18ClNO4S — CID 95321771
5-chloro-N-ethyl-N-[(2S)-1-methylsulfonylpropan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 95321771) has the molecular formula C15H18ClNO4S and a molecular weight of 343.83 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N-[(2S)-1-methylsulfonylpropan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-ethyl-N-[(2S)-1-methylsulfonylpropan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 95321771 |
| Molecular Formula | C15H18ClNO4S |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 5-chloro-N-ethyl-N-[(2S)-1-methylsulfonylpropan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2cc(Cl)ccc2o1)[C@@H](C)CS(C)(=O)=O |
| InChI | InChI=1S/C15H18ClNO4S/c1-4-17(10(2)9-22(3,19)20)15(18)14-8-11-7-12(16)5-6-13(11)21-14/h5-8,10H,4,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | RXVRKINDASDSIA-JTQLQIEISA-N |
| XLogP | 2.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |