C16H22ClFN2O3 — CID 95322496
(2-chloro-4-fluorophenyl)-[4-[(2S)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]methanone (PubChem CID 95322496) has the molecular formula C16H22ClFN2O3 and a molecular weight of 344.81 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[4-[(2S)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[4-[(2S)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95322496 |
| Molecular Formula | C16H22ClFN2O3 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[4-[(2S)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]methanone |
| SMILES | CCOC[C@@H](O)CN1CCN(C(=O)c2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClFN2O3/c1-2-23-11-13(21)10-19-5-7-20(8-6-19)16(22)14-4-3-12(18)9-15(14)17/h3-4,9,13,21H,2,5-8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | SDSNLUXTYJDSHT-ZDUSSCGKSA-N |
| XLogP | 1.63 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |