C16H21N5O — CID 95323908
4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzamide (PubChem CID 95323908) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzamide.
| Compound Name | 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 95323908 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2CCCC[C@@H]2Cn2cncn2)cc1 |
| InChI | InChI=1S/C16H21N5O/c17-16(22)14-6-4-13(5-7-14)9-20-8-2-1-3-15(20)10-21-12-18-11-19-21/h4-7,11-12,15H,1-3,8-10H2,(H2,17,22)/t15-/m1/s1 |
| InChIKey | HPPANHSIAKDJGE-OAHLLOKOSA-N |
| XLogP | 1.43 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |