About 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile
4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile (PubChem CID 95609800) has the molecular formula C16H19N5
and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile |
| PubChem CID | 95609800 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCCC[C@@H]2Cn2cncn2)cc1 |
| InChI | InChI=1S/C16H19N5/c17-9-14-4-6-15(7-5-14)10-20-8-2-1-3-16(20)11-21-13-18-12-19-21/h4-7,12-13,16H,1-3,8,10-11H2/t16-/m1/s1 |
| InChIKey | QMCMHJJIPKNARW-MRXNPFEDSA-N |
| XLogP | 2.20 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile?
The IUPAC name of 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile (CID 95609800) is 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile is N#Cc1ccc(CN2CCCC[C@@H]2Cn2cncn2)cc1.
What is the InChIKey of 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile?
The InChIKey is QMCMHJJIPKNARW-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H19N5/c17-9-14-4-6-15(7-5-14)10-20-8-2-1-3-16(20)11-21-13-18-12-19-21/h4-7,12-13,16H,1-3,8,10-11H2/t16-/m1/s1.
What are the key properties of 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile?
4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile has a molecular weight of 281.36 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R)-2-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]methyl]benzonitrile is sourced from PubChem (CID 95609800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).