C17H21N5O3 — CID 95325819
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]propan-1-one (PubChem CID 95325819) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95325819 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]propan-1-one |
| SMILES | Cc1nn(CCC(=O)N2CCC[C@H]2c2ccccn2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O3/c1-12-17(22(24)25)13(2)21(19-12)11-8-16(23)20-10-5-7-15(20)14-6-3-4-9-18-14/h3-4,6,9,15H,5,7-8,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | CAVXYUDSAFGWBF-HNNXBMFYSA-N |
| XLogP | 2.56 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|