About N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide
N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide (PubChem CID 95326337) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide.
Molecular Properties
| Compound Name | N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide |
| PubChem CID | 95326337 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)NC1CCOCC1)[C@H](C)n1cccn1 |
| InChI | InChI=1S/C14H24N4O2/c1-11(12(2)18-7-3-6-16-18)15-10-14(19)17-13-4-8-20-9-5-13/h3,6-7,11-13,15H,4-5,8-10H2,1-2H3,(H,17,19)/t11-,12+/m1/s1 |
| InChIKey | BWHICAGTQZHYDO-NEPJUHHUSA-N |
| XLogP | 0.72 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide?
The IUPAC name of N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide (CID 95326337) is N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide.
What is the SMILES notation for N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide?
The canonical SMILES for N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide is C[C@@H](NCC(=O)NC1CCOCC1)[C@H](C)n1cccn1.
What is the InChIKey of N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide?
The InChIKey is BWHICAGTQZHYDO-NEPJUHHUSA-N. The full InChI is InChI=1S/C14H24N4O2/c1-11(12(2)18-7-3-6-16-18)15-10-14(19)17-13-4-8-20-9-5-13/h3,6-7,11-13,15H,4-5,8-10H2,1-2H3,(H,17,19)/t11-,12+/m1/s1.
What are the key properties of N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide?
N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide has a molecular weight of 280.37 g/mol, XLogP of 0.72, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-4-yl)-2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide is sourced from PubChem (CID 95326337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).