C18H26N4OS — CID 95329792
2-[(R)-phenylsulfinyl]-N-[[(6S)-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]ethanamine (PubChem CID 95329792) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 2-[(R)-phenylsulfinyl]-N-[[(6S)-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]ethanamine.
| Compound Name | 2-[(R)-phenylsulfinyl]-N-[[(6S)-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 95329792 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-[(R)-phenylsulfinyl]-N-[[(6S)-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl]ethanamine |
| SMILES | CC(C)c1nnc2n1C[C@H](CNCC[S@@](=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C18H26N4OS/c1-14(2)18-21-20-17-9-8-15(13-22(17)18)12-19-10-11-24(23)16-6-4-3-5-7-16/h3-7,14-15,19H,8-13H2,1-2H3/t15-,24+/m0/s1 |
| InChIKey | MSSXLGLHUSQRMA-IZHWHUGBSA-N |
| XLogP | 2.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|