C14H18N4O — CID 105392234
[6-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-phenylmethanol (PubChem CID 105392234) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is [6-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-phenylmethanol.
| Compound Name | [6-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-phenylmethanol |
|---|---|
| PubChem CID | 105392234 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [6-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-phenylmethanol |
| SMILES | NCC1CCc2nnc(C(O)c3ccccc3)n2C1 |
| InChI | InChI=1S/C14H18N4O/c15-8-10-6-7-12-16-17-14(18(12)9-10)13(19)11-4-2-1-3-5-11/h1-5,10,13,19H,6-9,15H2 |
| InChIKey | DBDIONNKHSBHEH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |