C9H16N4O — CID 105392259
(3-ethoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanamine (PubChem CID 105392259) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is (3-ethoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanamine.
| Compound Name | (3-ethoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 105392259 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (3-ethoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methanamine |
| SMILES | CCOc1nnc2n1CC(CN)CC2 |
| InChI | InChI=1S/C9H16N4O/c1-2-14-9-12-11-8-4-3-7(5-10)6-13(8)9/h7H,2-6,10H2,1H3 |
| InChIKey | QSCKXVSLLFAGJO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |