C8H14N4O — CID 105392067
[6-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanol (PubChem CID 105392067) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is [6-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanol.
| Compound Name | [6-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 105392067 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | [6-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanol |
| SMILES | NCC1CCc2nnc(CO)n2C1 |
| InChI | InChI=1S/C8H14N4O/c9-3-6-1-2-7-10-11-8(5-13)12(7)4-6/h6,13H,1-5,9H2 |
| InChIKey | ZJUQXCOMQFWDBN-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |