C17H20N8 — CID 95329826
N-[(1-phenyltetrazol-5-yl)methyl]-1-[(2S)-1-pyridazin-3-ylpyrrolidin-2-yl]methanamine (PubChem CID 95329826) has the molecular formula C17H20N8 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[(1-phenyltetrazol-5-yl)methyl]-1-[(2S)-1-pyridazin-3-ylpyrrolidin-2-yl]methanamine.
| Compound Name | N-[(1-phenyltetrazol-5-yl)methyl]-1-[(2S)-1-pyridazin-3-ylpyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 95329826 |
| Molecular Formula | C17H20N8 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[(1-phenyltetrazol-5-yl)methyl]-1-[(2S)-1-pyridazin-3-ylpyrrolidin-2-yl]methanamine |
| SMILES | c1ccc(-n2nnnc2CNC[C@@H]2CCCN2c2cccnn2)cc1 |
| InChI | InChI=1S/C17H20N8/c1-2-6-14(7-3-1)25-17(21-22-23-25)13-18-12-15-8-5-11-24(15)16-9-4-10-19-20-16/h1-4,6-7,9-10,15,18H,5,8,11-13H2/t15-/m0/s1 |
| InChIKey | NFYJGWZBTUGRKJ-HNNXBMFYSA-N |
| XLogP | 1.21 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |