C17H22N4O2S — CID 95610651
N-[(4-methylsulfonylphenyl)methyl]-1-[(2S)-1-pyridazin-3-ylpyrrolidin-2-yl]methanamine (PubChem CID 95610651) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[(4-methylsulfonylphenyl)methyl]-1-[(2S)-1-pyridazin-3-ylpyrrolidin-2-yl]methanamine.
| Compound Name | N-[(4-methylsulfonylphenyl)methyl]-1-[(2S)-1-pyridazin-3-ylpyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 95610651 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[(4-methylsulfonylphenyl)methyl]-1-[(2S)-1-pyridazin-3-ylpyrrolidin-2-yl]methanamine |
| SMILES | CS(=O)(=O)c1ccc(CNC[C@@H]2CCCN2c2cccnn2)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-24(22,23)16-8-6-14(7-9-16)12-18-13-15-4-3-11-21(15)17-5-2-10-19-20-17/h2,5-10,15,18H,3-4,11-13H2,1H3/t15-/m0/s1 |
| InChIKey | DDQQUTRYDVMBDX-HNNXBMFYSA-N |
| XLogP | 1.64 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |