C12H15F2NO3S — CID 95331806
3-(difluoromethoxy)-N-[2-[(2R)-oxolan-2-yl]ethyl]thiophene-2-carboxamide (PubChem CID 95331806) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[2-[(2R)-oxolan-2-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | 3-(difluoromethoxy)-N-[2-[(2R)-oxolan-2-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 95331806 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-(difluoromethoxy)-N-[2-[(2R)-oxolan-2-yl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC[C@H]1CCCO1)c1sccc1OC(F)F |
| InChI | InChI=1S/C12H15F2NO3S/c13-12(14)18-9-4-7-19-10(9)11(16)15-5-3-8-2-1-6-17-8/h4,7-8,12H,1-3,5-6H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | QLCWUWDRAQFBDY-MRVPVSSYSA-N |
| XLogP | 2.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |