C19H21N3O2 — CID 95335952
[4-[(3S)-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methylurea (PubChem CID 95335952) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [4-[(3S)-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methylurea.
| Compound Name | [4-[(3S)-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methylurea |
|---|---|
| PubChem CID | 95335952 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [4-[(3S)-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methylurea |
| SMILES | C[C@H]1Cc2ccccc2N(C(=O)c2ccc(CNC(N)=O)cc2)C1 |
| InChI | InChI=1S/C19H21N3O2/c1-13-10-16-4-2-3-5-17(16)22(12-13)18(23)15-8-6-14(7-9-15)11-21-19(20)24/h2-9,13H,10-12H2,1H3,(H3,20,21,24)/t13-/m0/s1 |
| InChIKey | FNYWBRHHILCJSM-ZDUSSCGKSA-N |
| XLogP | 2.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |