C17H23N3OS2 — CID 95337619
2-(3-methylbutylsulfanyl)-N-[(1S)-1-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 95337619) has the molecular formula C17H23N3OS2 and a molecular weight of 349.53 g/mol. Its IUPAC name is 2-(3-methylbutylsulfanyl)-N-[(1S)-1-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(3-methylbutylsulfanyl)-N-[(1S)-1-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 95337619 |
| Molecular Formula | C17H23N3OS2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-(3-methylbutylsulfanyl)-N-[(1S)-1-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | CC(C)CCSCC(=O)N[C@@H](C)c1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C17H23N3OS2/c1-12(2)6-9-22-11-16(21)19-13(3)17-20-15(10-23-17)14-4-7-18-8-5-14/h4-5,7-8,10,12-13H,6,9,11H2,1-3H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | RAAVZNHAXRFRES-ZDUSSCGKSA-N |
| XLogP | 4.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|