C18H18N4OS — CID 95760159
1-[(1R)-1-(4-phenyl-1,3-thiazol-2-yl)ethyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 95760159) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-[(1R)-1-(4-phenyl-1,3-thiazol-2-yl)ethyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[(1R)-1-(4-phenyl-1,3-thiazol-2-yl)ethyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 95760159 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[(1R)-1-(4-phenyl-1,3-thiazol-2-yl)ethyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | C[C@@H](NC(=O)NCc1ccncc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H18N4OS/c1-13(21-18(23)20-11-14-7-9-19-10-8-14)17-22-16(12-24-17)15-5-3-2-4-6-15/h2-10,12-13H,11H2,1H3,(H2,20,21,23)/t13-/m1/s1 |
| InChIKey | SJWAUSASRHVIQY-CYBMUJFWSA-N |
| XLogP | 3.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |