C18H26N4O2 — CID 95338435
(2R)-N,N-dimethyl-1-[3-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]propyl]pyrrolidine-2-carboxamide (PubChem CID 95338435) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-1-[3-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N,N-dimethyl-1-[3-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95338435 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (2R)-N,N-dimethyl-1-[3-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]propyl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCCN1CCCNC(=O)/C=C/c1ccccn1 |
| InChI | InChI=1S/C18H26N4O2/c1-21(2)18(24)16-8-5-13-22(16)14-6-12-20-17(23)10-9-15-7-3-4-11-19-15/h3-4,7,9-11,16H,5-6,8,12-14H2,1-2H3,(H,20,23)/b10-9+/t16-/m1/s1 |
| InChIKey | LMXZZVUXUYWMGG-ZNFPLGDCSA-N |
| XLogP | 1.15 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|