C16H24N4O2S — CID 98481402
(2S)-N,N-dimethyl-1-[3-[[(Z)-3-(1,3-thiazol-4-yl)prop-2-enoyl]amino]propyl]pyrrolidine-2-carboxamide (PubChem CID 98481402) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-1-[3-[[(Z)-3-(1,3-thiazol-4-yl)prop-2-enoyl]amino]propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N,N-dimethyl-1-[3-[[(Z)-3-(1,3-thiazol-4-yl)prop-2-enoyl]amino]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 98481402 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2S)-N,N-dimethyl-1-[3-[[(Z)-3-(1,3-thiazol-4-yl)prop-2-enoyl]amino]propyl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CCCN1CCCNC(=O)/C=C\c1cscn1 |
| InChI | InChI=1S/C16H24N4O2S/c1-19(2)16(22)14-5-3-9-20(14)10-4-8-17-15(21)7-6-13-11-23-12-18-13/h6-7,11-12,14H,3-5,8-10H2,1-2H3,(H,17,21)/b7-6-/t14-/m0/s1 |
| InChIKey | FKQKAURYOIGMGI-AFNCTOJWSA-N |
| XLogP | 1.22 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|