C17H28N4O4 — CID 95341337
(2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-methyl-2-[[(2R)-oxolan-2-yl]methoxy]butanehydrazide (PubChem CID 95341337) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-methyl-2-[[(2R)-oxolan-2-yl]methoxy]butanehydrazide.
| Compound Name | (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-methyl-2-[[(2R)-oxolan-2-yl]methoxy]butanehydrazide |
|---|---|
| PubChem CID | 95341337 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-methyl-2-[[(2R)-oxolan-2-yl]methoxy]butanehydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)[C@@H](OC[C@H]2CCCO2)C(C)C)n1 |
| InChI | InChI=1S/C17H28N4O4/c1-11(2)16(25-10-14-6-5-7-24-14)17(23)19-18-15(22)9-21-13(4)8-12(3)20-21/h8,11,14,16H,5-7,9-10H2,1-4H3,(H,18,22)(H,19,23)/t14-,16+/m1/s1 |
| InChIKey | YWVQMVCYQDGCKQ-ZBFHGGJFSA-N |
| XLogP | 0.87 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|