C14H20N4O2 — CID 9424979
2-[(1R)-cyclopent-2-en-1-yl]-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]acetohydrazide (PubChem CID 9424979) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]acetohydrazide.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 9424979 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]acetohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)C[C@@H]2C=CCC2)n1 |
| InChI | InChI=1S/C14H20N4O2/c1-10-7-11(2)18(17-10)9-14(20)16-15-13(19)8-12-5-3-4-6-12/h3,5,7,12H,4,6,8-9H2,1-2H3,(H,15,19)(H,16,20)/t12-/m1/s1 |
| InChIKey | NVXXQETWPXXXKK-GFCCVEGCSA-N |
| XLogP | 1.00 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|